| Name | 1-(2-Fluorophenyl)piperazine |
| Synonyms | AKOS BBS-00003615 RARECHEM AH CK 0103 LABOTEST-BB LT00159366 1-(2-Fluorophenyl)piperazine 1-(2-Fluorphenyl)-piperazine 1-(2-FLUOROPHENYL)PIPERAZINE 1-(2-FLUOROPHENYL)-PIPERAZINE 2-(1-Piperazino)fluorobenzene 4-(2-fluorophenyl)piperazin-1-ium |
| CAS | 1011-15-0 |
| EINECS | 213-780-4 |
| InChI | InChI=1/C10H13FN2/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13/h1-4,12H,5-8H2/p+1 |
| Molecular Formula | C10H13FN2 |
| Molar Mass | 180.22 |
| Density | 1.141 g/mL at 25 °C (lit.) |
| Melting Point | 44-48℃ |
| Boling Point | 150 °C/3 mmHg (lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.0031mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless to light yellow |
| BRN | 611787 |
| pKa | 8.78±0.10(Predicted) |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.556(lit.) |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S24/25 - Avoid contact with skin and eyes. |
| UN IDs | 2923 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Hazard Note | Toxic |
| Hazard Class | 8 |
| Packing Group | II |
| use | intermediates for the synthesis of neuroactive compounds. |